C12H20N4O2 — CID 107185767
3-[5-(2,2-dimethylcyclohexyl)tetrazol-1-yl]propanoic acid (PubChem CID 107185767) has the molecular formula C12H20N4O2 and a molecular weight of 252.32 g/mol. Its IUPAC name is 3-[5-(2,2-dimethylcyclohexyl)tetrazol-1-yl]propanoic acid.
| Compound Name | 3-[5-(2,2-dimethylcyclohexyl)tetrazol-1-yl]propanoic acid |
|---|---|
| PubChem CID | 107185767 |
| Molecular Formula | C12H20N4O2 |
| Molecular Weight | 252.32 g/mol |
| Exact Mass | 252.16 |
| IUPAC Name | 3-[5-(2,2-dimethylcyclohexyl)tetrazol-1-yl]propanoic acid |
| SMILES | CC1(C)CCCCC1c1nnnn1CCC(=O)O |
| InChI | InChI=1S/C12H20N4O2/c1-12(2)7-4-3-5-9(12)11-13-14-15-16(11)8-6-10(17)18/h9H,3-8H2,1-2H3,(H,17,18) |
| InChIKey | USUCPGIQDAXRTG-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.32 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |