4-(5-cyclopentyltetrazol-1-yl)butanoic acid

C10H16N4O2 — CID 66045339

IUPAC4-(5-cyclopentyltetrazol-1-yl)butanoic acid
SMILESO=C(O)CCCn1nnnc1C1CCCC1
InChIInChI=1S/C10H16N4O2/c15-9(16)6-3-7-14-10(11-12-13-14)8-4-1-2-5-8/h8H,1-7H2,(H,15,16)
InChIKeyQVHOUCJYPQVCFZ-UHFFFAOYSA-N
MW224.26 g/mol
LogP1.20
Rot. Bonds5

About 4-(5-cyclopentyltetrazol-1-yl)butanoic acid

4-(5-cyclopentyltetrazol-1-yl)butanoic acid (PubChem CID 66045339) has the molecular formula C10H16N4O2 and a molecular weight of 224.26 g/mol. Its IUPAC name is 4-(5-cyclopentyltetrazol-1-yl)butanoic acid.

Molecular Properties

Compound Name4-(5-cyclopentyltetrazol-1-yl)butanoic acid
PubChem CID66045339
Molecular FormulaC10H16N4O2
Molecular Weight224.26 g/mol
Exact Mass224.13
IUPAC Name4-(5-cyclopentyltetrazol-1-yl)butanoic acid
SMILESO=C(O)CCCn1nnnc1C1CCCC1
InChIInChI=1S/C10H16N4O2/c15-9(16)6-3-7-14-10(11-12-13-14)8-4-1-2-5-8/h8H,1-7H2,(H,15,16)
InChIKeyQVHOUCJYPQVCFZ-UHFFFAOYSA-N
XLogP1.20
TPSA80.90 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds5
Heavy Atoms16
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500224.26
LogP ≤ 51.20
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Analyze 4-(5-cyclopentyltetrazol-1-yl)butanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

4-(5-cycloheptyltetrazol-1-yl)butanoic acid
CID 66046769
4-(5-cyclopentyltetrazol-1-yl)-2-methylbutanoic acid
CID 80541618
1-[(5-cyclopentyltetrazol-1-yl)methyl]cyclohexane-1-carboxylic acid
CID 115437179
3-[5-(2,2-dimethylcyclohexyl)tetrazol-1-yl]propanoic acid
CID 107185767
4-[5-(2,3-dihydro-1-benzothiophen-3-yl)tetrazol-1-yl]butanoic acid
CID 79213272
3-(5-cyclooctyltetrazol-1-yl)-2-methylpropanoic acid
CID 66047218
1-[(5-cyclopropyltetrazol-1-yl)methyl]cyclohexane-1-carboxylic acid
CID 115437185
4-[5-(diethylamino)tetrazol-1-yl]butanoic acid
CID 139677761
3-[(5-cyclohexyltetrazol-1-yl)methyl]benzoic acid
CID 84759051
4-(5-cyclopropyltetrazol-1-yl)-3-methoxybutanoic acid
CID 103160438
3-(5-cyclohexyltetrazol-1-yl)-3-cyclopropylpropanoic acid
CID 82002908
3-(5,6,7,8-tetrahydrotetrazolo[1,5-a]pyridin-8-yl)propanoic acid
CID 83879776

Frequently Asked Questions

What is the IUPAC name of 4-(5-cyclopentyltetrazol-1-yl)butanoic acid?
The IUPAC name of 4-(5-cyclopentyltetrazol-1-yl)butanoic acid (CID 66045339) is 4-(5-cyclopentyltetrazol-1-yl)butanoic acid.
What is the SMILES notation for 4-(5-cyclopentyltetrazol-1-yl)butanoic acid?
The canonical SMILES for 4-(5-cyclopentyltetrazol-1-yl)butanoic acid is O=C(O)CCCn1nnnc1C1CCCC1.
What is the InChIKey of 4-(5-cyclopentyltetrazol-1-yl)butanoic acid?
The InChIKey is QVHOUCJYPQVCFZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16N4O2/c15-9(16)6-3-7-14-10(11-12-13-14)8-4-1-2-5-8/h8H,1-7H2,(H,15,16).
What are the key properties of 4-(5-cyclopentyltetrazol-1-yl)butanoic acid?
4-(5-cyclopentyltetrazol-1-yl)butanoic acid has a molecular weight of 224.26 g/mol, XLogP of 1.20, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(5-cyclopentyltetrazol-1-yl)butanoic acid is sourced from PubChem (CID 66045339), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).