C27H36O6 — CID 10718624
methyl 2-[(1R,2S,4R,6R,9R,10R,11R,12S,15R,18S)-6-(furan-3-yl)-12-hydroxy-7,9,11,15-tetramethyl-3,17-dioxapentacyclo[9.6.1.02,9.04,8.015,18]octadec-7-en-10-yl]acetate (PubChem CID 10718624) has the molecular formula C27H36O6 and a molecular weight of 456.58 g/mol. Its IUPAC name is methyl 2-[(1R,2S,4R,6R,9R,10R,11R,12S,15R,18S)-6-(furan-3-yl)-12-hydroxy-7,9,11,15-tetramethyl-3,17-dioxapentacyclo[9.6.1.02,9.04,8.015,18]octadec-7-en-10-yl]acetate.
| Compound Name | methyl 2-[(1R,2S,4R,6R,9R,10R,11R,12S,15R,18S)-6-(furan-3-yl)-12-hydroxy-7,9,11,15-tetramethyl-3,17-dioxapentacyclo[9.6.1.02,9.04,8.015,18]octadec-7-en-10-yl]acetate |
|---|---|
| PubChem CID | 10718624 |
| Molecular Formula | C27H36O6 |
| Molecular Weight | 456.58 g/mol |
| Exact Mass | 456.25 |
| IUPAC Name | methyl 2-[(1R,2S,4R,6R,9R,10R,11R,12S,15R,18S)-6-(furan-3-yl)-12-hydroxy-7,9,11,15-tetramethyl-3,17-dioxapentacyclo[9.6.1.02,9.04,8.015,18]octadec-7-en-10-yl]acetate |
| SMILES | COC(=O)C[C@H]1[C@]2(C)C3=C(C)[C@H](c4ccoc4)C[C@H]3O[C@@H]2[C@@H]2OC[C@]3(C)CC[C@H](O)[C@@]1(C)[C@@H]23 |
| InChI | InChI=1S/C27H36O6/c1-14-16(15-7-9-31-12-15)10-17-21(14)27(4)18(11-20(29)30-5)26(3)19(28)6-8-25(2)13-32-22(23(25)26)24(27)33-17/h7,9,12,16-19,22-24,28H,6,8,10-11,13H2,1-5H3/t16-,17-,18-,19+,22-,23+,24-,25+,26+,27-/m1/s1 |
| InChIKey | NAXSSFQPEXJWGN-FEEXMUEUSA-N |
| XLogP | 4.23 |
| TPSA | 78.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.58 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|