C29H36O8 — CID 162999221
ethyl (1S,2R,3R,4R,8R,9S,10R,13R,15R)-13-(furan-3-yl)-2-hydroxy-9-(2-methoxy-2-oxoethyl)-4,8,10,12-tetramethyl-7-oxo-16-oxatetracyclo[8.6.0.03,8.011,15]hexadeca-5,11-diene-4-carboxylate (PubChem CID 162999221) has the molecular formula C29H36O8 and a molecular weight of 512.60 g/mol. Its IUPAC name is ethyl (1S,2R,3R,4R,8R,9S,10R,13R,15R)-13-(furan-3-yl)-2-hydroxy-9-(2-methoxy-2-oxoethyl)-4,8,10,12-tetramethyl-7-oxo-16-oxatetracyclo[8.6.0.03,8.011,15]hexadeca-5,11-diene-4-carboxylate.
| Compound Name | ethyl (1S,2R,3R,4R,8R,9S,10R,13R,15R)-13-(furan-3-yl)-2-hydroxy-9-(2-methoxy-2-oxoethyl)-4,8,10,12-tetramethyl-7-oxo-16-oxatetracyclo[8.6.0.03,8.011,15]hexadeca-5,11-diene-4-carboxylate |
|---|---|
| PubChem CID | 162999221 |
| Molecular Formula | C29H36O8 |
| Molecular Weight | 512.60 g/mol |
| Exact Mass | 512.24 |
| IUPAC Name | ethyl (1S,2R,3R,4R,8R,9S,10R,13R,15R)-13-(furan-3-yl)-2-hydroxy-9-(2-methoxy-2-oxoethyl)-4,8,10,12-tetramethyl-7-oxo-16-oxatetracyclo[8.6.0.03,8.011,15]hexadeca-5,11-diene-4-carboxylate |
| SMILES | CCOC(=O)[C@]1(C)C=CC(=O)[C@]2(C)[C@@H](CC(=O)OC)[C@]3(C)C4=C(C)[C@H](c5ccoc5)C[C@H]4O[C@@H]3[C@H](O)[C@H]21 |
| InChI | InChI=1S/C29H36O8/c1-7-36-26(33)27(3)10-8-20(30)28(4)19(13-21(31)34-6)29(5)22-15(2)17(16-9-11-35-14-16)12-18(22)37-25(29)23(32)24(27)28/h8-11,14,17-19,23-25,32H,7,12-13H2,1-6H3/t17-,18-,19-,23-,24+,25-,27-,28+,29-/m1/s1 |
| InChIKey | JZUPHKPARYJLTP-ZKBJOAKBSA-N |
| XLogP | 3.74 |
| TPSA | 112.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.60 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|