C28H32O7 — CID 166874142
methyl 2-[7,9,11,15-tetramethyl-6-(2-methylfuran-3-yl)-12,16-dioxo-3,17-dioxapentacyclo[9.6.1.02,9.04,8.015,18]octadeca-7,13-dien-10-yl]acetate (PubChem CID 166874142) has the molecular formula C28H32O7 and a molecular weight of 480.56 g/mol. Its IUPAC name is methyl 2-[7,9,11,15-tetramethyl-6-(2-methylfuran-3-yl)-12,16-dioxo-3,17-dioxapentacyclo[9.6.1.02,9.04,8.015,18]octadeca-7,13-dien-10-yl]acetate.
| Compound Name | methyl 2-[7,9,11,15-tetramethyl-6-(2-methylfuran-3-yl)-12,16-dioxo-3,17-dioxapentacyclo[9.6.1.02,9.04,8.015,18]octadeca-7,13-dien-10-yl]acetate |
|---|---|
| PubChem CID | 166874142 |
| Molecular Formula | C28H32O7 |
| Molecular Weight | 480.56 g/mol |
| Exact Mass | 480.21 |
| IUPAC Name | methyl 2-[7,9,11,15-tetramethyl-6-(2-methylfuran-3-yl)-12,16-dioxo-3,17-dioxapentacyclo[9.6.1.02,9.04,8.015,18]octadeca-7,13-dien-10-yl]acetate |
| SMILES | COC(=O)CC1C2(C)C3=C(C)C(c4ccoc4C)CC3OC2C2OC(=O)C3(C)C=CC(=O)C1(C)C23 |
| InChI | InChI=1S/C28H32O7/c1-13-16(15-8-10-33-14(15)2)11-17-21(13)28(5)18(12-20(30)32-6)27(4)19(29)7-9-26(3)23(27)22(24(28)34-17)35-25(26)31/h7-10,16-18,22-24H,11-12H2,1-6H3 |
| InChIKey | KGMYTQYBDDRJTQ-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 92.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.56 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|