C34H34O8 — CID 166567885
methyl 2-[(1R,6R,9R,10S,11R,15R,18R)-6-[2-(4-formylphenyl)furan-3-yl]-7,9,11,15-tetramethyl-12,16-dioxo-3,17-dioxapentacyclo[9.6.1.02,9.04,8.015,18]octadeca-7,13-dien-10-yl]acetate (PubChem CID 166567885) has the molecular formula C34H34O8 and a molecular weight of 570.64 g/mol. Its IUPAC name is methyl 2-[(1R,6R,9R,10S,11R,15R,18R)-6-[2-(4-formylphenyl)furan-3-yl]-7,9,11,15-tetramethyl-12,16-dioxo-3,17-dioxapentacyclo[9.6.1.02,9.04,8.015,18]octadeca-7,13-dien-10-yl]acetate.
| Compound Name | methyl 2-[(1R,6R,9R,10S,11R,15R,18R)-6-[2-(4-formylphenyl)furan-3-yl]-7,9,11,15-tetramethyl-12,16-dioxo-3,17-dioxapentacyclo[9.6.1.02,9.04,8.015,18]octadeca-7,13-dien-10-yl]acetate |
|---|---|
| PubChem CID | 166567885 |
| Molecular Formula | C34H34O8 |
| Molecular Weight | 570.64 g/mol |
| Exact Mass | 570.23 |
| IUPAC Name | methyl 2-[(1R,6R,9R,10S,11R,15R,18R)-6-[2-(4-formylphenyl)furan-3-yl]-7,9,11,15-tetramethyl-12,16-dioxo-3,17-dioxapentacyclo[9.6.1.02,9.04,8.015,18]octadeca-7,13-dien-10-yl]acetate |
| SMILES | COC(=O)C[C@@H]1[C@@]2(C)C(=O)C=C[C@@]3(C)C(=O)O[C@@H](C4OC5C[C@@H](c6ccoc6-c6ccc(C=O)cc6)C(C)=C5[C@]41C)[C@H]23 |
| InChI | InChI=1S/C34H34O8/c1-17-21(20-11-13-40-27(20)19-8-6-18(16-35)7-9-19)14-22-26(17)34(4)23(15-25(37)39-5)33(3)24(36)10-12-32(2)29(33)28(30(34)41-22)42-31(32)38/h6-13,16,21-23,28-30H,14-15H2,1-5H3/t21-,22?,23-,28-,29+,30?,32-,33+,34-/m1/s1 |
| InChIKey | BTYHKURJHJRUGW-JUZKYZAHSA-N |
| XLogP | 5.22 |
| TPSA | 109.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.64 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|