C27H30O8 — CID 164574439
methyl 2-[(1R,2S,4R,6R,9R,11R,15R,18R)-7,9,11,15-tetramethyl-12,16-dioxo-6-(5-oxo-2H-furan-4-yl)-3,17-dioxapentacyclo[9.6.1.02,9.04,8.015,18]octadeca-7,13-dien-10-yl]acetate (PubChem CID 164574439) has the molecular formula C27H30O8 and a molecular weight of 482.53 g/mol. Its IUPAC name is methyl 2-[(1R,2S,4R,6R,9R,11R,15R,18R)-7,9,11,15-tetramethyl-12,16-dioxo-6-(5-oxo-2H-furan-4-yl)-3,17-dioxapentacyclo[9.6.1.02,9.04,8.015,18]octadeca-7,13-dien-10-yl]acetate.
| Compound Name | methyl 2-[(1R,2S,4R,6R,9R,11R,15R,18R)-7,9,11,15-tetramethyl-12,16-dioxo-6-(5-oxo-2H-furan-4-yl)-3,17-dioxapentacyclo[9.6.1.02,9.04,8.015,18]octadeca-7,13-dien-10-yl]acetate |
|---|---|
| PubChem CID | 164574439 |
| Molecular Formula | C27H30O8 |
| Molecular Weight | 482.53 g/mol |
| Exact Mass | 482.19 |
| IUPAC Name | methyl 2-[(1R,2S,4R,6R,9R,11R,15R,18R)-7,9,11,15-tetramethyl-12,16-dioxo-6-(5-oxo-2H-furan-4-yl)-3,17-dioxapentacyclo[9.6.1.02,9.04,8.015,18]octadeca-7,13-dien-10-yl]acetate |
| SMILES | COC(=O)CC1[C@]2(C)C3=C(C)[C@H](C4=CCOC4=O)C[C@H]3O[C@@H]2[C@@H]2OC(=O)[C@]3(C)C=CC(=O)[C@@]1(C)[C@@H]23 |
| InChI | InChI=1S/C27H30O8/c1-12-14(13-7-9-33-23(13)30)10-15-19(12)27(4)16(11-18(29)32-5)26(3)17(28)6-8-25(2)21(26)20(22(27)34-15)35-24(25)31/h6-8,14-16,20-22H,9-11H2,1-5H3/t14-,15-,16?,20-,21+,22-,25-,26+,27-/m1/s1 |
| InChIKey | CQCUQXJULGROED-ZSHNHELTSA-N |
| XLogP | 2.47 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.53 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|