C27H32O8 — CID 162922534
methyl 2-[(1R,2S,4R,6R,9R,10R,11R,15R,18S)-6-[(2S)-2-hydroxy-5-oxo-2H-furan-4-yl]-7,9,11,15-tetramethyl-14-oxo-3,17-dioxapentacyclo[9.6.1.02,9.04,8.015,18]octadeca-7,12-dien-10-yl]acetate (PubChem CID 162922534) has the molecular formula C27H32O8 and a molecular weight of 484.55 g/mol. Its IUPAC name is methyl 2-[(1R,2S,4R,6R,9R,10R,11R,15R,18S)-6-[(2S)-2-hydroxy-5-oxo-2H-furan-4-yl]-7,9,11,15-tetramethyl-14-oxo-3,17-dioxapentacyclo[9.6.1.02,9.04,8.015,18]octadeca-7,12-dien-10-yl]acetate.
| Compound Name | methyl 2-[(1R,2S,4R,6R,9R,10R,11R,15R,18S)-6-[(2S)-2-hydroxy-5-oxo-2H-furan-4-yl]-7,9,11,15-tetramethyl-14-oxo-3,17-dioxapentacyclo[9.6.1.02,9.04,8.015,18]octadeca-7,12-dien-10-yl]acetate |
|---|---|
| PubChem CID | 162922534 |
| Molecular Formula | C27H32O8 |
| Molecular Weight | 484.55 g/mol |
| Exact Mass | 484.21 |
| IUPAC Name | methyl 2-[(1R,2S,4R,6R,9R,10R,11R,15R,18S)-6-[(2S)-2-hydroxy-5-oxo-2H-furan-4-yl]-7,9,11,15-tetramethyl-14-oxo-3,17-dioxapentacyclo[9.6.1.02,9.04,8.015,18]octadeca-7,12-dien-10-yl]acetate |
| SMILES | COC(=O)C[C@@H]1[C@@]2(C)C=CC(=O)[C@@]3(C)CO[C@@H]([C@H]4O[C@@H]5C[C@@H](C6=C[C@@H](O)OC6=O)C(C)=C5[C@]41C)[C@@H]23 |
| InChI | InChI=1S/C27H32O8/c1-12-13(14-9-19(30)35-24(14)31)8-15-20(12)27(4)16(10-18(29)32-5)25(2)7-6-17(28)26(3)11-33-21(22(25)26)23(27)34-15/h6-7,9,13,15-16,19,21-23,30H,8,10-11H2,1-5H3/t13-,15-,16-,19+,21-,22+,23-,25-,26-,27-/m1/s1 |
| InChIKey | LUGYVZIXJLEPQF-VARPYRLLSA-N |
| XLogP | 2.26 |
| TPSA | 108.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.55 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|