C34H44O11 — CID 162853682
[14-acetyloxy-6-(2-hydroxy-5-oxo-2H-furan-4-yl)-10-(2-methoxy-2-oxoethyl)-7,9,11,15-tetramethyl-3,17-dioxapentacyclo[9.6.1.02,9.04,8.015,18]octadec-7-en-12-yl] 2-methylbut-2-enoate (PubChem CID 162853682) has the molecular formula C34H44O11 and a molecular weight of 628.72 g/mol. Its IUPAC name is [14-acetyloxy-6-(2-hydroxy-5-oxo-2H-furan-4-yl)-10-(2-methoxy-2-oxoethyl)-7,9,11,15-tetramethyl-3,17-dioxapentacyclo[9.6.1.02,9.04,8.015,18]octadec-7-en-12-yl] 2-methylbut-2-enoate.
| Compound Name | [14-acetyloxy-6-(2-hydroxy-5-oxo-2H-furan-4-yl)-10-(2-methoxy-2-oxoethyl)-7,9,11,15-tetramethyl-3,17-dioxapentacyclo[9.6.1.02,9.04,8.015,18]octadec-7-en-12-yl] 2-methylbut-2-enoate |
|---|---|
| PubChem CID | 162853682 |
| Molecular Formula | C34H44O11 |
| Molecular Weight | 628.72 g/mol |
| Exact Mass | 628.29 |
| IUPAC Name | [14-acetyloxy-6-(2-hydroxy-5-oxo-2H-furan-4-yl)-10-(2-methoxy-2-oxoethyl)-7,9,11,15-tetramethyl-3,17-dioxapentacyclo[9.6.1.02,9.04,8.015,18]octadec-7-en-12-yl] 2-methylbut-2-enoate |
| SMILES | CC=C(C)C(=O)OC1CC(OC(C)=O)C2(C)COC3C4OC5CC(C6=CC(O)OC6=O)C(C)=C5C4(C)C(CC(=O)OC)C1(C)C32 |
| InChI | InChI=1S/C34H44O11/c1-9-15(2)30(38)44-23-13-22(42-17(4)35)32(5)14-41-27-28(32)33(23,6)21(12-24(36)40-8)34(7)26-16(3)18(10-20(26)43-29(27)34)19-11-25(37)45-31(19)39/h9,11,18,20-23,25,27-29,37H,10,12-14H2,1-8H3 |
| InChIKey | FVEVYGNIVRCALL-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 143.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.72 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|