C8H11ClN2O — CID 107186575
2-chloro-5-(2-methylcyclopentyl)-1,3,4-oxadiazole (PubChem CID 107186575) has the molecular formula C8H11ClN2O and a molecular weight of 186.64 g/mol. Its IUPAC name is 2-chloro-5-(2-methylcyclopentyl)-1,3,4-oxadiazole.
| Compound Name | 2-chloro-5-(2-methylcyclopentyl)-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 107186575 |
| Molecular Formula | C8H11ClN2O |
| Molecular Weight | 186.64 g/mol |
| Exact Mass | 186.06 |
| IUPAC Name | 2-chloro-5-(2-methylcyclopentyl)-1,3,4-oxadiazole |
| SMILES | CC1CCCC1c1nnc(Cl)o1 |
| InChI | InChI=1S/C8H11ClN2O/c1-5-3-2-4-6(5)7-10-11-8(9)12-7/h5-6H,2-4H2,1H3 |
| InChIKey | ZYSKIFFTVHNRLQ-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.64 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |