C11H14Cl2N2 — CID 130805079
4,6-dichloro-2-(2-methylcyclohexyl)pyrimidine (PubChem CID 130805079) has the molecular formula C11H14Cl2N2 and a molecular weight of 245.15 g/mol. Its IUPAC name is 4,6-dichloro-2-(2-methylcyclohexyl)pyrimidine.
| Compound Name | 4,6-dichloro-2-(2-methylcyclohexyl)pyrimidine |
|---|---|
| PubChem CID | 130805079 |
| Molecular Formula | C11H14Cl2N2 |
| Molecular Weight | 245.15 g/mol |
| Exact Mass | 244.05 |
| IUPAC Name | 4,6-dichloro-2-(2-methylcyclohexyl)pyrimidine |
| SMILES | CC1CCCCC1c1nc(Cl)cc(Cl)n1 |
| InChI | InChI=1S/C11H14Cl2N2/c1-7-4-2-3-5-8(7)11-14-9(12)6-10(13)15-11/h6-8H,2-5H2,1H3 |
| InChIKey | HLUGKOVDIJTJCY-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.15 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |