C11H17ClN2O — CID 131071191
5-(2-chloroethyl)-3-(2-methylcyclohexyl)-1,2,4-oxadiazole (PubChem CID 131071191) has the molecular formula C11H17ClN2O and a molecular weight of 228.72 g/mol. Its IUPAC name is 5-(2-chloroethyl)-3-(2-methylcyclohexyl)-1,2,4-oxadiazole.
| Compound Name | 5-(2-chloroethyl)-3-(2-methylcyclohexyl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 131071191 |
| Molecular Formula | C11H17ClN2O |
| Molecular Weight | 228.72 g/mol |
| Exact Mass | 228.10 |
| IUPAC Name | 5-(2-chloroethyl)-3-(2-methylcyclohexyl)-1,2,4-oxadiazole |
| SMILES | CC1CCCCC1c1noc(CCCl)n1 |
| InChI | InChI=1S/C11H17ClN2O/c1-8-4-2-3-5-9(8)11-13-10(6-7-12)15-14-11/h8-9H,2-7H2,1H3 |
| InChIKey | PDSPDNQYQBZIFN-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.72 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|