C8H10Cl3N3 — CID 155895891
4,6-dichloro-2-pyrrolidin-2-ylpyrimidine;hydrochloride (PubChem CID 155895891) has the molecular formula C8H10Cl3N3 and a molecular weight of 254.55 g/mol. Its IUPAC name is 4,6-dichloro-2-pyrrolidin-2-ylpyrimidine;hydrochloride.
| Compound Name | 4,6-dichloro-2-pyrrolidin-2-ylpyrimidine;hydrochloride |
|---|---|
| PubChem CID | 155895891 |
| Molecular Formula | C8H10Cl3N3 |
| Molecular Weight | 254.55 g/mol |
| Exact Mass | 252.99 |
| IUPAC Name | 4,6-dichloro-2-pyrrolidin-2-ylpyrimidine;hydrochloride |
| SMILES | Cl.Clc1cc(Cl)nc(C2CCCN2)n1 |
| InChI | InChI=1S/C8H9Cl2N3.ClH/c9-6-4-7(10)13-8(12-6)5-2-1-3-11-5;/h4-5,11H,1-3H2;1H |
| InChIKey | WOUBDEWPWIDMFU-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.55 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |