C5H10ClN5 — CID 42962676
5-pyrrolidin-2-yl-2H-tetrazole;hydrochloride (PubChem CID 42962676) has the molecular formula C5H10ClN5 and a molecular weight of 175.62 g/mol. Its IUPAC name is 5-pyrrolidin-2-yl-2H-tetrazole;hydrochloride.
| Compound Name | 5-pyrrolidin-2-yl-2H-tetrazole;hydrochloride |
|---|---|
| PubChem CID | 42962676 |
| Molecular Formula | C5H10ClN5 |
| Molecular Weight | 175.62 g/mol |
| Exact Mass | 175.06 |
| IUPAC Name | 5-pyrrolidin-2-yl-2H-tetrazole;hydrochloride |
| SMILES | C1CNC(c2nn[nH]n2)C1.Cl |
| InChI | InChI=1S/C5H9N5.ClH/c1-2-4(6-3-1)5-7-9-10-8-5;/h4,6H,1-3H2,(H,7,8,9,10);1H |
| InChIKey | XJSLLRDADMUYGJ-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.62 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |