About cesium;hydride;5-[(2R)-pyrrolidin-2-yl]-2H-tetrazole
cesium;hydride;5-[(2R)-pyrrolidin-2-yl]-2H-tetrazole (PubChem CID 173085630) has the molecular formula C5H10CsN5
and a molecular weight of 273.08 g/mol. Its IUPAC name is cesium;hydride;5-[(2R)-pyrrolidin-2-yl]-2H-tetrazole.
Molecular Properties
| Compound Name | cesium;hydride;5-[(2R)-pyrrolidin-2-yl]-2H-tetrazole |
| PubChem CID | 173085630 |
| Molecular Formula | C5H10CsN5 |
| Molecular Weight | 273.08 g/mol |
| Exact Mass | 273.00 |
| IUPAC Name | cesium;hydride;5-[(2R)-pyrrolidin-2-yl]-2H-tetrazole |
| SMILES | C1CN[C@@H](c2nn[nH]n2)C1.[Cs+].[H-] |
| InChI | InChI=1S/C5H9N5.Cs.H/c1-2-4(6-3-1)5-7-9-10-8-5;;/h4,6H,1-3H2,(H,7,8,9,10);;/q;+1;-1/t4-;;/m1../s1 |
| InChIKey | IFNGJXAXURSOST-RZFWHQLPSA-N |
| XLogP | -3.26 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.08 |
| LogP ≤ 5 | -3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze cesium;hydride;5-[(2R)-pyrrolidin-2-yl]-2H-tetrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cesium;hydride;5-[(2R)-pyrrolidin-2-yl]-2H-tetrazole?
The IUPAC name of cesium;hydride;5-[(2R)-pyrrolidin-2-yl]-2H-tetrazole (CID 173085630) is cesium;hydride;5-[(2R)-pyrrolidin-2-yl]-2H-tetrazole.
What is the SMILES notation for cesium;hydride;5-[(2R)-pyrrolidin-2-yl]-2H-tetrazole?
The canonical SMILES for cesium;hydride;5-[(2R)-pyrrolidin-2-yl]-2H-tetrazole is C1CN[C@@H](c2nn[nH]n2)C1.[Cs+].[H-].
What is the InChIKey of cesium;hydride;5-[(2R)-pyrrolidin-2-yl]-2H-tetrazole?
The InChIKey is IFNGJXAXURSOST-RZFWHQLPSA-N. The full InChI is InChI=1S/C5H9N5.Cs.H/c1-2-4(6-3-1)5-7-9-10-8-5;;/h4,6H,1-3H2,(H,7,8,9,10);;/q;+1;-1/t4-;;/m1../s1.
What are the key properties of cesium;hydride;5-[(2R)-pyrrolidin-2-yl]-2H-tetrazole?
cesium;hydride;5-[(2R)-pyrrolidin-2-yl]-2H-tetrazole has a molecular weight of 273.08 g/mol, XLogP of -3.26, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for cesium;hydride;5-[(2R)-pyrrolidin-2-yl]-2H-tetrazole is sourced from PubChem (CID 173085630), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).