C7H14N6 — CID 106638235
1-pyrrolidin-2-yl-N-(2H-tetrazol-5-ylmethyl)methanamine (PubChem CID 106638235) has the molecular formula C7H14N6 and a molecular weight of 182.23 g/mol. Its IUPAC name is 1-pyrrolidin-2-yl-N-(2H-tetrazol-5-ylmethyl)methanamine.
| Compound Name | 1-pyrrolidin-2-yl-N-(2H-tetrazol-5-ylmethyl)methanamine |
|---|---|
| PubChem CID | 106638235 |
| Molecular Formula | C7H14N6 |
| Molecular Weight | 182.23 g/mol |
| Exact Mass | 182.13 |
| IUPAC Name | 1-pyrrolidin-2-yl-N-(2H-tetrazol-5-ylmethyl)methanamine |
| SMILES | C1CNC(CNCc2nn[nH]n2)C1 |
| InChI | InChI=1S/C7H14N6/c1-2-6(9-3-1)4-8-5-7-10-12-13-11-7/h6,8-9H,1-5H2,(H,10,11,12,13) |
| InChIKey | VVCMAALLDQAUGI-UHFFFAOYSA-N |
| XLogP | -0.96 |
| TPSA | 78.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.23 |
| LogP ≤ 5 | -0.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |