C10H10Cl6N4 — CID 138679171
2-piperidin-2-yl-4,6-bis(trichloromethyl)-1,3,5-triazine (PubChem CID 138679171) has the molecular formula C10H10Cl6N4 and a molecular weight of 398.94 g/mol. Its IUPAC name is 2-piperidin-2-yl-4,6-bis(trichloromethyl)-1,3,5-triazine.
| Compound Name | 2-piperidin-2-yl-4,6-bis(trichloromethyl)-1,3,5-triazine |
|---|---|
| PubChem CID | 138679171 |
| Molecular Formula | C10H10Cl6N4 |
| Molecular Weight | 398.94 g/mol |
| Exact Mass | 395.90 |
| IUPAC Name | 2-piperidin-2-yl-4,6-bis(trichloromethyl)-1,3,5-triazine |
| SMILES | ClC(Cl)(Cl)c1nc(C2CCCCN2)nc(C(Cl)(Cl)Cl)n1 |
| InChI | InChI=1S/C10H10Cl6N4/c11-9(12,13)7-18-6(5-3-1-2-4-17-5)19-8(20-7)10(14,15)16/h5,17H,1-4H2 |
| InChIKey | LZBJOLXORXMVQY-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.94 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|