C8H13N3O — CID 97184692
3-[(2S)-azepan-2-yl]-1,2,4-oxadiazole (PubChem CID 97184692) has the molecular formula C8H13N3O and a molecular weight of 167.21 g/mol. Its IUPAC name is 3-[(2S)-azepan-2-yl]-1,2,4-oxadiazole.
| Compound Name | 3-[(2S)-azepan-2-yl]-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 97184692 |
| Molecular Formula | C8H13N3O |
| Molecular Weight | 167.21 g/mol |
| Exact Mass | 167.11 |
| IUPAC Name | 3-[(2S)-azepan-2-yl]-1,2,4-oxadiazole |
| SMILES | c1nc([C@@H]2CCCCCN2)no1 |
| InChI | InChI=1S/C8H13N3O/c1-2-4-7(9-5-3-1)8-10-6-12-11-8/h6-7,9H,1-5H2/t7-/m0/s1 |
| InChIKey | PARYBDOLVNBMAW-ZETCQYMHSA-N |
| XLogP | 1.27 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.21 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |