C10H11ClN4 — CID 84750927
5-chloro-2-pyrrolidin-2-yl-[1,2,4]triazolo[1,5-a]pyridine (PubChem CID 84750927) has the molecular formula C10H11ClN4 and a molecular weight of 222.68 g/mol. Its IUPAC name is 5-chloro-2-pyrrolidin-2-yl-[1,2,4]triazolo[1,5-a]pyridine.
| Compound Name | 5-chloro-2-pyrrolidin-2-yl-[1,2,4]triazolo[1,5-a]pyridine |
|---|---|
| PubChem CID | 84750927 |
| Molecular Formula | C10H11ClN4 |
| Molecular Weight | 222.68 g/mol |
| Exact Mass | 222.07 |
| IUPAC Name | 5-chloro-2-pyrrolidin-2-yl-[1,2,4]triazolo[1,5-a]pyridine |
| SMILES | Clc1cccc2nc(C3CCCN3)nn12 |
| InChI | InChI=1S/C10H11ClN4/c11-8-4-1-5-9-13-10(14-15(8)9)7-3-2-6-12-7/h1,4-5,7,12H,2-3,6H2 |
| InChIKey | WHJZSDUNJRKQND-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 42.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.68 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|