C12H16N4 — CID 117131741
(2-pyrrolidin-2-ylimidazo[1,2-a]pyridin-5-yl)methanamine (PubChem CID 117131741) has the molecular formula C12H16N4 and a molecular weight of 216.29 g/mol. Its IUPAC name is (2-pyrrolidin-2-ylimidazo[1,2-a]pyridin-5-yl)methanamine.
| Compound Name | (2-pyrrolidin-2-ylimidazo[1,2-a]pyridin-5-yl)methanamine |
|---|---|
| PubChem CID | 117131741 |
| Molecular Formula | C12H16N4 |
| Molecular Weight | 216.29 g/mol |
| Exact Mass | 216.14 |
| IUPAC Name | (2-pyrrolidin-2-ylimidazo[1,2-a]pyridin-5-yl)methanamine |
| SMILES | NCc1cccc2nc(C3CCCN3)cn12 |
| InChI | InChI=1S/C12H16N4/c13-7-9-3-1-5-12-15-11(8-16(9)12)10-4-2-6-14-10/h1,3,5,8,10,14H,2,4,6-7,13H2 |
| InChIKey | FKSJCOLVISCDDT-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 55.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.29 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |