C8H13N3O — CID 115013285
(4-pyrrolidin-2-yl-1,3-oxazol-2-yl)methanamine (PubChem CID 115013285) has the molecular formula C8H13N3O and a molecular weight of 167.21 g/mol. Its IUPAC name is (4-pyrrolidin-2-yl-1,3-oxazol-2-yl)methanamine.
| Compound Name | (4-pyrrolidin-2-yl-1,3-oxazol-2-yl)methanamine |
|---|---|
| PubChem CID | 115013285 |
| Molecular Formula | C8H13N3O |
| Molecular Weight | 167.21 g/mol |
| Exact Mass | 167.11 |
| IUPAC Name | (4-pyrrolidin-2-yl-1,3-oxazol-2-yl)methanamine |
| SMILES | NCc1nc(C2CCCN2)co1 |
| InChI | InChI=1S/C8H13N3O/c9-4-8-11-7(5-12-8)6-2-1-3-10-6/h5-6,10H,1-4,9H2 |
| InChIKey | WZDMIYZAQUGHFJ-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 64.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.21 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |