C9H15N3S — CID 83292303
2-(2-pyrrolidin-2-yl-1,3-thiazol-4-yl)ethanamine (PubChem CID 83292303) has the molecular formula C9H15N3S and a molecular weight of 197.31 g/mol. Its IUPAC name is 2-(2-pyrrolidin-2-yl-1,3-thiazol-4-yl)ethanamine.
| Compound Name | 2-(2-pyrrolidin-2-yl-1,3-thiazol-4-yl)ethanamine |
|---|---|
| PubChem CID | 83292303 |
| Molecular Formula | C9H15N3S |
| Molecular Weight | 197.31 g/mol |
| Exact Mass | 197.10 |
| IUPAC Name | 2-(2-pyrrolidin-2-yl-1,3-thiazol-4-yl)ethanamine |
| SMILES | NCCc1csc(C2CCCN2)n1 |
| InChI | InChI=1S/C9H15N3S/c10-4-3-7-6-13-9(12-7)8-2-1-5-11-8/h6,8,11H,1-5,10H2 |
| InChIKey | FWZNIXAFTVJPLQ-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.31 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |