C8H13N5S — CID 154005365
2-(4-pyrrolidin-2-yl-1,3-thiazol-2-yl)guanidine (PubChem CID 154005365) has the molecular formula C8H13N5S and a molecular weight of 211.29 g/mol. Its IUPAC name is 2-(4-pyrrolidin-2-yl-1,3-thiazol-2-yl)guanidine.
| Compound Name | 2-(4-pyrrolidin-2-yl-1,3-thiazol-2-yl)guanidine |
|---|---|
| PubChem CID | 154005365 |
| Molecular Formula | C8H13N5S |
| Molecular Weight | 211.29 g/mol |
| Exact Mass | 211.09 |
| IUPAC Name | 2-(4-pyrrolidin-2-yl-1,3-thiazol-2-yl)guanidine |
| SMILES | NC(N)=Nc1nc(C2CCCN2)cs1 |
| InChI | InChI=1S/C8H13N5S/c9-7(10)13-8-12-6(4-14-8)5-2-1-3-11-5/h4-5,11H,1-3H2,(H4,9,10,12,13) |
| InChIKey | OQZXERYYGRSIBC-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 89.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.29 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|