C12H15ClN4 — CID 117131935
5-chloro-2-(1-methylpiperidin-2-yl)-[1,2,4]triazolo[1,5-a]pyridine (PubChem CID 117131935) has the molecular formula C12H15ClN4 and a molecular weight of 250.73 g/mol. Its IUPAC name is 5-chloro-2-(1-methylpiperidin-2-yl)-[1,2,4]triazolo[1,5-a]pyridine.
| Compound Name | 5-chloro-2-(1-methylpiperidin-2-yl)-[1,2,4]triazolo[1,5-a]pyridine |
|---|---|
| PubChem CID | 117131935 |
| Molecular Formula | C12H15ClN4 |
| Molecular Weight | 250.73 g/mol |
| Exact Mass | 250.10 |
| IUPAC Name | 5-chloro-2-(1-methylpiperidin-2-yl)-[1,2,4]triazolo[1,5-a]pyridine |
| SMILES | CN1CCCCC1c1nc2cccc(Cl)n2n1 |
| InChI | InChI=1S/C12H15ClN4/c1-16-8-3-2-5-9(16)12-14-11-7-4-6-10(13)17(11)15-12/h4,6-7,9H,2-3,5,8H2,1H3 |
| InChIKey | IVEHFKCSGJISCX-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 33.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.73 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|