C10H12Cl2N2 — CID 130612938
2,6-dichloro-3-[(2S)-piperidin-2-yl]pyridine (PubChem CID 130612938) has the molecular formula C10H12Cl2N2 and a molecular weight of 231.13 g/mol. Its IUPAC name is 2,6-dichloro-3-[(2S)-piperidin-2-yl]pyridine.
| Compound Name | 2,6-dichloro-3-[(2S)-piperidin-2-yl]pyridine |
|---|---|
| PubChem CID | 130612938 |
| Molecular Formula | C10H12Cl2N2 |
| Molecular Weight | 231.13 g/mol |
| Exact Mass | 230.04 |
| IUPAC Name | 2,6-dichloro-3-[(2S)-piperidin-2-yl]pyridine |
| SMILES | Clc1ccc([C@@H]2CCCCN2)c(Cl)n1 |
| InChI | InChI=1S/C10H12Cl2N2/c11-9-5-4-7(10(12)14-9)8-3-1-2-6-13-8/h4-5,8,13H,1-3,6H2/t8-/m0/s1 |
| InChIKey | NLQJBZZHRXRCFT-QMMMGPOBSA-N |
| XLogP | 3.20 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.13 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|