C9H11Cl2N3 — CID 131093662
(2S)-2-(2,6-dichloro-3-pyridinyl)piperazine (PubChem CID 131093662) has the molecular formula C9H11Cl2N3 and a molecular weight of 232.11 g/mol. Its IUPAC name is (2S)-2-(2,6-dichloro-3-pyridinyl)piperazine.
| Compound Name | (2S)-2-(2,6-dichloro-3-pyridinyl)piperazine |
|---|---|
| PubChem CID | 131093662 |
| Molecular Formula | C9H11Cl2N3 |
| Molecular Weight | 232.11 g/mol |
| Exact Mass | 231.03 |
| IUPAC Name | (2S)-2-(2,6-dichloro-3-pyridinyl)piperazine |
| SMILES | Clc1ccc([C@H]2CNCCN2)c(Cl)n1 |
| InChI | InChI=1S/C9H11Cl2N3/c10-8-2-1-6(9(11)14-8)7-5-12-3-4-13-7/h1-2,7,12-13H,3-5H2/t7-/m1/s1 |
| InChIKey | VLXMKJCLKAYABC-SSDOTTSWSA-N |
| XLogP | 1.62 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.11 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|