C13H20N2O — CID 107186691
(2,2-dimethylcyclopentyl)-(1-ethylpyrazol-4-yl)methanone (PubChem CID 107186691) has the molecular formula C13H20N2O and a molecular weight of 220.32 g/mol. Its IUPAC name is (2,2-dimethylcyclopentyl)-(1-ethylpyrazol-4-yl)methanone.
| Compound Name | (2,2-dimethylcyclopentyl)-(1-ethylpyrazol-4-yl)methanone |
|---|---|
| PubChem CID | 107186691 |
| Molecular Formula | C13H20N2O |
| Molecular Weight | 220.32 g/mol |
| Exact Mass | 220.16 |
| IUPAC Name | (2,2-dimethylcyclopentyl)-(1-ethylpyrazol-4-yl)methanone |
| SMILES | CCn1cc(C(=O)C2CCCC2(C)C)cn1 |
| InChI | InChI=1S/C13H20N2O/c1-4-15-9-10(8-14-15)12(16)11-6-5-7-13(11,2)3/h8-9,11H,4-7H2,1-3H3 |
| InChIKey | QQTAZRRRZGHSEC-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.32 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |