C11H16N2OS2 — CID 115385636
(1-ethylpyrazol-4-yl)-(3-methyl-1,4-dithian-2-yl)methanone (PubChem CID 115385636) has the molecular formula C11H16N2OS2 and a molecular weight of 256.40 g/mol. Its IUPAC name is (1-ethylpyrazol-4-yl)-(3-methyl-1,4-dithian-2-yl)methanone.
| Compound Name | (1-ethylpyrazol-4-yl)-(3-methyl-1,4-dithian-2-yl)methanone |
|---|---|
| PubChem CID | 115385636 |
| Molecular Formula | C11H16N2OS2 |
| Molecular Weight | 256.40 g/mol |
| Exact Mass | 256.07 |
| IUPAC Name | (1-ethylpyrazol-4-yl)-(3-methyl-1,4-dithian-2-yl)methanone |
| SMILES | CCn1cc(C(=O)C2SCCSC2C)cn1 |
| InChI | InChI=1S/C11H16N2OS2/c1-3-13-7-9(6-12-13)10(14)11-8(2)15-4-5-16-11/h6-8,11H,3-5H2,1-2H3 |
| InChIKey | RYVXWZBOSUBRIR-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.40 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |