C14H27N — CID 107189392
3-cyclopropyl-1-(2,2-dimethylcyclohexyl)propan-1-amine (PubChem CID 107189392) has the molecular formula C14H27N and a molecular weight of 209.38 g/mol. Its IUPAC name is 3-cyclopropyl-1-(2,2-dimethylcyclohexyl)propan-1-amine.
| Compound Name | 3-cyclopropyl-1-(2,2-dimethylcyclohexyl)propan-1-amine |
|---|---|
| PubChem CID | 107189392 |
| Molecular Formula | C14H27N |
| Molecular Weight | 209.38 g/mol |
| Exact Mass | 209.21 |
| IUPAC Name | 3-cyclopropyl-1-(2,2-dimethylcyclohexyl)propan-1-amine |
| SMILES | CC1(C)CCCCC1C(N)CCC1CC1 |
| InChI | InChI=1S/C14H27N/c1-14(2)10-4-3-5-12(14)13(15)9-8-11-6-7-11/h11-13H,3-10,15H2,1-2H3 |
| InChIKey | BTVCSWVSYVDMFU-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.38 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |