C16H31N — CID 114193227
3-cyclopentyl-1-(2,2-dimethylcyclohexyl)propan-1-amine (PubChem CID 114193227) has the molecular formula C16H31N and a molecular weight of 237.43 g/mol. Its IUPAC name is 3-cyclopentyl-1-(2,2-dimethylcyclohexyl)propan-1-amine.
| Compound Name | 3-cyclopentyl-1-(2,2-dimethylcyclohexyl)propan-1-amine |
|---|---|
| PubChem CID | 114193227 |
| Molecular Formula | C16H31N |
| Molecular Weight | 237.43 g/mol |
| Exact Mass | 237.25 |
| IUPAC Name | 3-cyclopentyl-1-(2,2-dimethylcyclohexyl)propan-1-amine |
| SMILES | CC1(C)CCCCC1C(N)CCC1CCCC1 |
| InChI | InChI=1S/C16H31N/c1-16(2)12-6-5-9-14(16)15(17)11-10-13-7-3-4-8-13/h13-15H,3-12,17H2,1-2H3 |
| InChIKey | LJWVBVCNYVBHJM-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.43 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |