About (3,5-dimethylcyclohexyl)-(2,2-dimethylcyclopentyl)methanol
(3,5-dimethylcyclohexyl)-(2,2-dimethylcyclopentyl)methanol (PubChem CID 107192398) has the molecular formula C16H30O
and a molecular weight of 238.41 g/mol. Its IUPAC name is (3,5-dimethylcyclohexyl)-(2,2-dimethylcyclopentyl)methanol.
Molecular Properties
| Compound Name | (3,5-dimethylcyclohexyl)-(2,2-dimethylcyclopentyl)methanol |
| PubChem CID | 107192398 |
| Molecular Formula | C16H30O |
| Molecular Weight | 238.41 g/mol |
| Exact Mass | 238.23 |
| IUPAC Name | (3,5-dimethylcyclohexyl)-(2,2-dimethylcyclopentyl)methanol |
| SMILES | CC1CC(C)CC(C(O)C2CCCC2(C)C)C1 |
| InChI | InChI=1S/C16H30O/c1-11-8-12(2)10-13(9-11)15(17)14-6-5-7-16(14,3)4/h11-15,17H,5-10H2,1-4H3 |
| InChIKey | GTFMRUPUERYBRH-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.41 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (3,5-dimethylcyclohexyl)-(2,2-dimethylcyclopentyl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3,5-dimethylcyclohexyl)-(2,2-dimethylcyclopentyl)methanol?
The IUPAC name of (3,5-dimethylcyclohexyl)-(2,2-dimethylcyclopentyl)methanol (CID 107192398) is (3,5-dimethylcyclohexyl)-(2,2-dimethylcyclopentyl)methanol.
What is the SMILES notation for (3,5-dimethylcyclohexyl)-(2,2-dimethylcyclopentyl)methanol?
The canonical SMILES for (3,5-dimethylcyclohexyl)-(2,2-dimethylcyclopentyl)methanol is CC1CC(C)CC(C(O)C2CCCC2(C)C)C1.
What is the InChIKey of (3,5-dimethylcyclohexyl)-(2,2-dimethylcyclopentyl)methanol?
The InChIKey is GTFMRUPUERYBRH-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H30O/c1-11-8-12(2)10-13(9-11)15(17)14-6-5-7-16(14,3)4/h11-15,17H,5-10H2,1-4H3.
What are the key properties of (3,5-dimethylcyclohexyl)-(2,2-dimethylcyclopentyl)methanol?
(3,5-dimethylcyclohexyl)-(2,2-dimethylcyclopentyl)methanol has a molecular weight of 238.41 g/mol, XLogP of 4.25, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3,5-dimethylcyclohexyl)-(2,2-dimethylcyclopentyl)methanol is sourced from PubChem (CID 107192398), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).