C16H30O3S — CID 107192685
(2,2-dimethylcyclohexyl)-(3-methylsulfonylcyclohexyl)methanol (PubChem CID 107192685) has the molecular formula C16H30O3S and a molecular weight of 302.48 g/mol. Its IUPAC name is (2,2-dimethylcyclohexyl)-(3-methylsulfonylcyclohexyl)methanol.
| Compound Name | (2,2-dimethylcyclohexyl)-(3-methylsulfonylcyclohexyl)methanol |
|---|---|
| PubChem CID | 107192685 |
| Molecular Formula | C16H30O3S |
| Molecular Weight | 302.48 g/mol |
| Exact Mass | 302.19 |
| IUPAC Name | (2,2-dimethylcyclohexyl)-(3-methylsulfonylcyclohexyl)methanol |
| SMILES | CC1(C)CCCCC1C(O)C1CCCC(S(C)(=O)=O)C1 |
| InChI | InChI=1S/C16H30O3S/c1-16(2)10-5-4-9-14(16)15(17)12-7-6-8-13(11-12)20(3,18)19/h12-15,17H,4-11H2,1-3H3 |
| InChIKey | HLVPLHOXOFSOHP-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.48 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |