C11H19N3O — CID 107192940
(2,2-dimethylcyclopentyl)-(3-methyltriazol-4-yl)methanol (PubChem CID 107192940) has the molecular formula C11H19N3O and a molecular weight of 209.29 g/mol. Its IUPAC name is (2,2-dimethylcyclopentyl)-(3-methyltriazol-4-yl)methanol.
| Compound Name | (2,2-dimethylcyclopentyl)-(3-methyltriazol-4-yl)methanol |
|---|---|
| PubChem CID | 107192940 |
| Molecular Formula | C11H19N3O |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.15 |
| IUPAC Name | (2,2-dimethylcyclopentyl)-(3-methyltriazol-4-yl)methanol |
| SMILES | Cn1nncc1C(O)C1CCCC1(C)C |
| InChI | InChI=1S/C11H19N3O/c1-11(2)6-4-5-8(11)10(15)9-7-12-13-14(9)3/h7-8,10,15H,4-6H2,1-3H3 |
| InChIKey | ZXMJMGKJJZFBJO-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |