C11H17ClN2O — CID 107192965
(4-chloro-1-methylpyrazol-5-yl)-(2-methylcyclopentyl)methanol (PubChem CID 107192965) has the molecular formula C11H17ClN2O and a molecular weight of 228.72 g/mol. Its IUPAC name is (4-chloro-1-methylpyrazol-5-yl)-(2-methylcyclopentyl)methanol.
| Compound Name | (4-chloro-1-methylpyrazol-5-yl)-(2-methylcyclopentyl)methanol |
|---|---|
| PubChem CID | 107192965 |
| Molecular Formula | C11H17ClN2O |
| Molecular Weight | 228.72 g/mol |
| Exact Mass | 228.10 |
| IUPAC Name | (4-chloro-1-methylpyrazol-5-yl)-(2-methylcyclopentyl)methanol |
| SMILES | CC1CCCC1C(O)c1c(Cl)cnn1C |
| InChI | InChI=1S/C11H17ClN2O/c1-7-4-3-5-8(7)11(15)10-9(12)6-13-14(10)2/h6-8,11,15H,3-5H2,1-2H3 |
| InChIKey | KPMNLVOFUJJNKM-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.72 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |