C10H15ClN2OS — CID 114645048
(4-chloro-1-methylpyrazol-5-yl)-(thian-2-yl)methanol (PubChem CID 114645048) has the molecular formula C10H15ClN2OS and a molecular weight of 246.76 g/mol. Its IUPAC name is (4-chloro-1-methylpyrazol-5-yl)-(thian-2-yl)methanol.
| Compound Name | (4-chloro-1-methylpyrazol-5-yl)-(thian-2-yl)methanol |
|---|---|
| PubChem CID | 114645048 |
| Molecular Formula | C10H15ClN2OS |
| Molecular Weight | 246.76 g/mol |
| Exact Mass | 246.06 |
| IUPAC Name | (4-chloro-1-methylpyrazol-5-yl)-(thian-2-yl)methanol |
| SMILES | Cn1ncc(Cl)c1C(O)C1CCCCS1 |
| InChI | InChI=1S/C10H15ClN2OS/c1-13-9(7(11)6-12-13)10(14)8-4-2-3-5-15-8/h6,8,10,14H,2-5H2,1H3 |
| InChIKey | VEUINKFGDIKDBH-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.76 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |