C9H13BrN2OS — CID 114645036
(4-bromo-1-methylpyrazol-5-yl)-(thiolan-2-yl)methanol (PubChem CID 114645036) has the molecular formula C9H13BrN2OS and a molecular weight of 277.19 g/mol. Its IUPAC name is (4-bromo-1-methylpyrazol-5-yl)-(thiolan-2-yl)methanol.
| Compound Name | (4-bromo-1-methylpyrazol-5-yl)-(thiolan-2-yl)methanol |
|---|---|
| PubChem CID | 114645036 |
| Molecular Formula | C9H13BrN2OS |
| Molecular Weight | 277.19 g/mol |
| Exact Mass | 275.99 |
| IUPAC Name | (4-bromo-1-methylpyrazol-5-yl)-(thiolan-2-yl)methanol |
| SMILES | Cn1ncc(Br)c1C(O)C1CCCS1 |
| InChI | InChI=1S/C9H13BrN2OS/c1-12-8(6(10)5-11-12)9(13)7-3-2-4-14-7/h5,7,9,13H,2-4H2,1H3 |
| InChIKey | IDHYXBVLGBDVRA-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.19 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |