C11H18BrN3 — CID 114646840
(4-bromo-1-methylpyrazol-5-yl)-cyclohexylmethanamine (PubChem CID 114646840) has the molecular formula C11H18BrN3 and a molecular weight of 272.19 g/mol. Its IUPAC name is (4-bromo-1-methylpyrazol-5-yl)-cyclohexylmethanamine.
| Compound Name | (4-bromo-1-methylpyrazol-5-yl)-cyclohexylmethanamine |
|---|---|
| PubChem CID | 114646840 |
| Molecular Formula | C11H18BrN3 |
| Molecular Weight | 272.19 g/mol |
| Exact Mass | 271.07 |
| IUPAC Name | (4-bromo-1-methylpyrazol-5-yl)-cyclohexylmethanamine |
| SMILES | Cn1ncc(Br)c1C(N)C1CCCCC1 |
| InChI | InChI=1S/C11H18BrN3/c1-15-11(9(12)7-14-15)10(13)8-5-3-2-4-6-8/h7-8,10H,2-6,13H2,1H3 |
| InChIKey | CFCUMMWDUOQBJU-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.19 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |