C9H13BrN2O3 — CID 115839299
(4-bromo-1-methylpyrazol-5-yl)-(1,4-dioxan-2-yl)methanol (PubChem CID 115839299) has the molecular formula C9H13BrN2O3 and a molecular weight of 277.12 g/mol. Its IUPAC name is (4-bromo-1-methylpyrazol-5-yl)-(1,4-dioxan-2-yl)methanol.
| Compound Name | (4-bromo-1-methylpyrazol-5-yl)-(1,4-dioxan-2-yl)methanol |
|---|---|
| PubChem CID | 115839299 |
| Molecular Formula | C9H13BrN2O3 |
| Molecular Weight | 277.12 g/mol |
| Exact Mass | 276.01 |
| IUPAC Name | (4-bromo-1-methylpyrazol-5-yl)-(1,4-dioxan-2-yl)methanol |
| SMILES | Cn1ncc(Br)c1C(O)C1COCCO1 |
| InChI | InChI=1S/C9H13BrN2O3/c1-12-8(6(10)4-11-12)9(13)7-5-14-2-3-15-7/h4,7,9,13H,2-3,5H2,1H3 |
| InChIKey | DOGMFPLKDNECKE-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.12 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |