C8H13N3O3 — CID 130530429
1,4-dioxan-2-yl-(2-methyl-1,2,4-triazol-3-yl)methanol (PubChem CID 130530429) has the molecular formula C8H13N3O3 and a molecular weight of 199.21 g/mol. Its IUPAC name is 1,4-dioxan-2-yl-(2-methyl-1,2,4-triazol-3-yl)methanol.
| Compound Name | 1,4-dioxan-2-yl-(2-methyl-1,2,4-triazol-3-yl)methanol |
|---|---|
| PubChem CID | 130530429 |
| Molecular Formula | C8H13N3O3 |
| Molecular Weight | 199.21 g/mol |
| Exact Mass | 199.10 |
| IUPAC Name | 1,4-dioxan-2-yl-(2-methyl-1,2,4-triazol-3-yl)methanol |
| SMILES | Cn1ncnc1C(O)C1COCCO1 |
| InChI | InChI=1S/C8H13N3O3/c1-11-8(9-5-10-11)7(12)6-4-13-2-3-14-6/h5-7,12H,2-4H2,1H3 |
| InChIKey | OWDMLPZKDRKCBS-UHFFFAOYSA-N |
| XLogP | -0.74 |
| TPSA | 69.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.21 |
| LogP ≤ 5 | -0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |