C12H20N2O4 — CID 115837776
1,4-dioxan-2-yl-(4-methoxy-1-propylpyrazol-5-yl)methanol (PubChem CID 115837776) has the molecular formula C12H20N2O4 and a molecular weight of 256.30 g/mol. Its IUPAC name is 1,4-dioxan-2-yl-(4-methoxy-1-propylpyrazol-5-yl)methanol.
| Compound Name | 1,4-dioxan-2-yl-(4-methoxy-1-propylpyrazol-5-yl)methanol |
|---|---|
| PubChem CID | 115837776 |
| Molecular Formula | C12H20N2O4 |
| Molecular Weight | 256.30 g/mol |
| Exact Mass | 256.14 |
| IUPAC Name | 1,4-dioxan-2-yl-(4-methoxy-1-propylpyrazol-5-yl)methanol |
| SMILES | CCCn1ncc(OC)c1C(O)C1COCCO1 |
| InChI | InChI=1S/C12H20N2O4/c1-3-4-14-11(9(16-2)7-13-14)12(15)10-8-17-5-6-18-10/h7,10,12,15H,3-6,8H2,1-2H3 |
| InChIKey | GWIHZOLYMVMVOU-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 65.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.30 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |