C10H15ClN2O3 — CID 115834933
(4-chloro-1-ethylpyrazol-5-yl)-(1,4-dioxan-2-yl)methanol (PubChem CID 115834933) has the molecular formula C10H15ClN2O3 and a molecular weight of 246.69 g/mol. Its IUPAC name is (4-chloro-1-ethylpyrazol-5-yl)-(1,4-dioxan-2-yl)methanol.
| Compound Name | (4-chloro-1-ethylpyrazol-5-yl)-(1,4-dioxan-2-yl)methanol |
|---|---|
| PubChem CID | 115834933 |
| Molecular Formula | C10H15ClN2O3 |
| Molecular Weight | 246.69 g/mol |
| Exact Mass | 246.08 |
| IUPAC Name | (4-chloro-1-ethylpyrazol-5-yl)-(1,4-dioxan-2-yl)methanol |
| SMILES | CCn1ncc(Cl)c1C(O)C1COCCO1 |
| InChI | InChI=1S/C10H15ClN2O3/c1-2-13-9(7(11)5-12-13)10(14)8-6-15-3-4-16-8/h5,8,10,14H,2-4,6H2,1H3 |
| InChIKey | YVSNQWUVUPUYEH-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.69 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |