C6H12O3 — CID 57186415
1-(1,4-dioxan-2-yl)ethanol (PubChem CID 57186415) has the molecular formula C6H12O3 and a molecular weight of 132.16 g/mol. Its IUPAC name is 1-(1,4-dioxan-2-yl)ethanol.
| Compound Name | 1-(1,4-dioxan-2-yl)ethanol |
|---|---|
| PubChem CID | 57186415 |
| Molecular Formula | C6H12O3 |
| Molecular Weight | 132.16 g/mol |
| Exact Mass | 132.08 |
| IUPAC Name | 1-(1,4-dioxan-2-yl)ethanol |
| SMILES | CC(O)C1COCCO1 |
| InChI | InChI=1S/C6H12O3/c1-5(7)6-4-8-2-3-9-6/h5-7H,2-4H2,1H3 |
| InChIKey | RZHOKKNAPROOJQ-UHFFFAOYSA-N |
| XLogP | -0.22 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 132.16 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |