C8H12O3 — CID 65351176
1-(1,4-dioxan-2-yl)but-3-yn-1-ol (PubChem CID 65351176) has the molecular formula C8H12O3 and a molecular weight of 156.18 g/mol. Its IUPAC name is 1-(1,4-dioxan-2-yl)but-3-yn-1-ol.
| Compound Name | 1-(1,4-dioxan-2-yl)but-3-yn-1-ol |
|---|---|
| PubChem CID | 65351176 |
| Molecular Formula | C8H12O3 |
| Molecular Weight | 156.18 g/mol |
| Exact Mass | 156.08 |
| IUPAC Name | 1-(1,4-dioxan-2-yl)but-3-yn-1-ol |
| SMILES | C#CCC(O)C1COCCO1 |
| InChI | InChI=1S/C8H12O3/c1-2-3-7(9)8-6-10-4-5-11-8/h1,7-9H,3-6H2 |
| InChIKey | RACDWVXJFOXEEF-UHFFFAOYSA-N |
| XLogP | -0.21 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.18 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|