C9H11BrO3S — CID 115278605
(4-bromothiophen-3-yl)-(1,4-dioxan-2-yl)methanol (PubChem CID 115278605) has the molecular formula C9H11BrO3S and a molecular weight of 279.15 g/mol. Its IUPAC name is (4-bromothiophen-3-yl)-(1,4-dioxan-2-yl)methanol.
| Compound Name | (4-bromothiophen-3-yl)-(1,4-dioxan-2-yl)methanol |
|---|---|
| PubChem CID | 115278605 |
| Molecular Formula | C9H11BrO3S |
| Molecular Weight | 279.15 g/mol |
| Exact Mass | 277.96 |
| IUPAC Name | (4-bromothiophen-3-yl)-(1,4-dioxan-2-yl)methanol |
| SMILES | OC(c1cscc1Br)C1COCCO1 |
| InChI | InChI=1S/C9H11BrO3S/c10-7-5-14-4-6(7)9(11)8-3-12-1-2-13-8/h4-5,8-9,11H,1-3H2 |
| InChIKey | SZSIIHACLIVALE-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.15 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |