C11H19BrN4S — CID 105255309
[(4-bromo-1-propan-2-ylpyrazol-5-yl)-(thiolan-2-yl)methyl]hydrazine (PubChem CID 105255309) has the molecular formula C11H19BrN4S and a molecular weight of 319.27 g/mol. Its IUPAC name is [(4-bromo-1-propan-2-ylpyrazol-5-yl)-(thiolan-2-yl)methyl]hydrazine.
| Compound Name | [(4-bromo-1-propan-2-ylpyrazol-5-yl)-(thiolan-2-yl)methyl]hydrazine |
|---|---|
| PubChem CID | 105255309 |
| Molecular Formula | C11H19BrN4S |
| Molecular Weight | 319.27 g/mol |
| Exact Mass | 318.05 |
| IUPAC Name | [(4-bromo-1-propan-2-ylpyrazol-5-yl)-(thiolan-2-yl)methyl]hydrazine |
| SMILES | CC(C)n1ncc(Br)c1C(NN)C1CCCS1 |
| InChI | InChI=1S/C11H19BrN4S/c1-7(2)16-11(8(12)6-14-16)10(15-13)9-4-3-5-17-9/h6-7,9-10,15H,3-5,13H2,1-2H3 |
| InChIKey | LXXSVORFWSFYCC-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 55.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.27 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|