C11H10ClN3O2S — CID 107193541
5-amino-3-chloro-2-[(4-methyl-1,3-thiazol-2-yl)amino]benzoic acid (PubChem CID 107193541) has the molecular formula C11H10ClN3O2S and a molecular weight of 283.74 g/mol. Its IUPAC name is 5-amino-3-chloro-2-[(4-methyl-1,3-thiazol-2-yl)amino]benzoic acid.
| Compound Name | 5-amino-3-chloro-2-[(4-methyl-1,3-thiazol-2-yl)amino]benzoic acid |
|---|---|
| PubChem CID | 107193541 |
| Molecular Formula | C11H10ClN3O2S |
| Molecular Weight | 283.74 g/mol |
| Exact Mass | 283.02 |
| IUPAC Name | 5-amino-3-chloro-2-[(4-methyl-1,3-thiazol-2-yl)amino]benzoic acid |
| SMILES | Cc1csc(Nc2c(Cl)cc(N)cc2C(=O)O)n1 |
| InChI | InChI=1S/C11H10ClN3O2S/c1-5-4-18-11(14-5)15-9-7(10(16)17)2-6(13)3-8(9)12/h2-4H,13H2,1H3,(H,14,15)(H,16,17) |
| InChIKey | CPZHLUUKDCXJHO-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 88.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.74 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|