2-[(4-methyl-1,3-thiazol-2-yl)amino]quinoline-4-carboxylic acid

C14H11N3O2S — CID 43332285

IUPAC2-[(4-methyl-1,3-thiazol-2-yl)amino]quinoline-4-carboxylic acid
SMILESCc1csc(Nc2cc(C(=O)O)c3ccccc3n2)n1
InChIInChI=1S/C14H11N3O2S/c1-8-7-20-14(15-8)17-12-6-10(13(18)19)9-4-2-3-5-11(9)16-12/h2-7H,1H3,(H,18,19)(H,15,16,17)
InChIKeyHELIHUIYEMCOOP-UHFFFAOYSA-N
MW285.33 g/mol
LogP3.44
Rot. Bonds3

About 2-[(4-methyl-1,3-thiazol-2-yl)amino]quinoline-4-carboxylic acid

2-[(4-methyl-1,3-thiazol-2-yl)amino]quinoline-4-carboxylic acid (PubChem CID 43332285) has the molecular formula C14H11N3O2S and a molecular weight of 285.33 g/mol. Its IUPAC name is 2-[(4-methyl-1,3-thiazol-2-yl)amino]quinoline-4-carboxylic acid.

Molecular Properties

Compound Name2-[(4-methyl-1,3-thiazol-2-yl)amino]quinoline-4-carboxylic acid
PubChem CID43332285
Molecular FormulaC14H11N3O2S
Molecular Weight285.33 g/mol
Exact Mass285.06
IUPAC Name2-[(4-methyl-1,3-thiazol-2-yl)amino]quinoline-4-carboxylic acid
SMILESCc1csc(Nc2cc(C(=O)O)c3ccccc3n2)n1
InChIInChI=1S/C14H11N3O2S/c1-8-7-20-14(15-8)17-12-6-10(13(18)19)9-4-2-3-5-11(9)16-12/h2-7H,1H3,(H,18,19)(H,15,16,17)
InChIKeyHELIHUIYEMCOOP-UHFFFAOYSA-N
XLogP3.44
TPSA75.11 Ų
H-Bond Donors2
H-Bond Acceptors5
Rotatable Bonds3
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500285.33
LogP ≤ 53.44
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 105

Analyze 2-[(4-methyl-1,3-thiazol-2-yl)amino]quinoline-4-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[(4-methyl-1,3-thiazol-2-yl)amino]quinoline-4-carboxylic acid?
The IUPAC name of 2-[(4-methyl-1,3-thiazol-2-yl)amino]quinoline-4-carboxylic acid (CID 43332285) is 2-[(4-methyl-1,3-thiazol-2-yl)amino]quinoline-4-carboxylic acid.
What is the SMILES notation for 2-[(4-methyl-1,3-thiazol-2-yl)amino]quinoline-4-carboxylic acid?
The canonical SMILES for 2-[(4-methyl-1,3-thiazol-2-yl)amino]quinoline-4-carboxylic acid is Cc1csc(Nc2cc(C(=O)O)c3ccccc3n2)n1.
What is the InChIKey of 2-[(4-methyl-1,3-thiazol-2-yl)amino]quinoline-4-carboxylic acid?
The InChIKey is HELIHUIYEMCOOP-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H11N3O2S/c1-8-7-20-14(15-8)17-12-6-10(13(18)19)9-4-2-3-5-11(9)16-12/h2-7H,1H3,(H,18,19)(H,15,16,17).
What are the key properties of 2-[(4-methyl-1,3-thiazol-2-yl)amino]quinoline-4-carboxylic acid?
2-[(4-methyl-1,3-thiazol-2-yl)amino]quinoline-4-carboxylic acid has a molecular weight of 285.33 g/mol, XLogP of 3.44, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(4-methyl-1,3-thiazol-2-yl)amino]quinoline-4-carboxylic acid is sourced from PubChem (CID 43332285), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).