C26H42O6Si — CID 10719454
[(2R,6R)-2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-6-[2-[(4-methoxyphenyl)methoxy]ethyl]-3,6-dihydro-2H-pyran-4-yl]oxy-triethylsilane (PubChem CID 10719454) has the molecular formula C26H42O6Si and a molecular weight of 478.70 g/mol. Its IUPAC name is [(2R,6R)-2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-6-[2-[(4-methoxyphenyl)methoxy]ethyl]-3,6-dihydro-2H-pyran-4-yl]oxy-triethylsilane.
| Compound Name | [(2R,6R)-2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-6-[2-[(4-methoxyphenyl)methoxy]ethyl]-3,6-dihydro-2H-pyran-4-yl]oxy-triethylsilane |
|---|---|
| PubChem CID | 10719454 |
| Molecular Formula | C26H42O6Si |
| Molecular Weight | 478.70 g/mol |
| Exact Mass | 478.28 |
| IUPAC Name | [(2R,6R)-2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-6-[2-[(4-methoxyphenyl)methoxy]ethyl]-3,6-dihydro-2H-pyran-4-yl]oxy-triethylsilane |
| SMILES | CC[Si](CC)(CC)OC1=C[C@@H](CCOCc2ccc(OC)cc2)O[C@@H]([C@@H]2COC(C)(C)O2)C1 |
| InChI | InChI=1S/C26H42O6Si/c1-7-33(8-2,9-3)32-23-16-22(30-24(17-23)25-19-29-26(4,5)31-25)14-15-28-18-20-10-12-21(27-6)13-11-20/h10-13,16,22,24-25H,7-9,14-15,17-19H2,1-6H3/t22-,24-,25+/m1/s1 |
| InChIKey | HYKSNAOTOXWWIT-GPXOXTDOSA-N |
| XLogP | 5.82 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.70 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|