C13H13BrClN3OS — CID 107195251
5-amino-2-[(4-bromothiophen-2-yl)methyl-methylamino]-3-chlorobenzamide (PubChem CID 107195251) has the molecular formula C13H13BrClN3OS and a molecular weight of 374.69 g/mol. Its IUPAC name is 5-amino-2-[(4-bromothiophen-2-yl)methyl-methylamino]-3-chlorobenzamide.
| Compound Name | 5-amino-2-[(4-bromothiophen-2-yl)methyl-methylamino]-3-chlorobenzamide |
|---|---|
| PubChem CID | 107195251 |
| Molecular Formula | C13H13BrClN3OS |
| Molecular Weight | 374.69 g/mol |
| Exact Mass | 372.97 |
| IUPAC Name | 5-amino-2-[(4-bromothiophen-2-yl)methyl-methylamino]-3-chlorobenzamide |
| SMILES | CN(Cc1cc(Br)cs1)c1c(Cl)cc(N)cc1C(N)=O |
| InChI | InChI=1S/C13H13BrClN3OS/c1-18(5-9-2-7(14)6-20-9)12-10(13(17)19)3-8(16)4-11(12)15/h2-4,6H,5,16H2,1H3,(H2,17,19) |
| InChIKey | WDOMBHVPGSQCKC-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 72.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.69 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|