C15H23ClN2O2 — CID 107196678
ethyl 5-amino-3-chloro-2-(3,3-dimethylbutan-2-ylamino)benzoate (PubChem CID 107196678) has the molecular formula C15H23ClN2O2 and a molecular weight of 298.81 g/mol. Its IUPAC name is ethyl 5-amino-3-chloro-2-(3,3-dimethylbutan-2-ylamino)benzoate.
| Compound Name | ethyl 5-amino-3-chloro-2-(3,3-dimethylbutan-2-ylamino)benzoate |
|---|---|
| PubChem CID | 107196678 |
| Molecular Formula | C15H23ClN2O2 |
| Molecular Weight | 298.81 g/mol |
| Exact Mass | 298.14 |
| IUPAC Name | ethyl 5-amino-3-chloro-2-(3,3-dimethylbutan-2-ylamino)benzoate |
| SMILES | CCOC(=O)c1cc(N)cc(Cl)c1NC(C)C(C)(C)C |
| InChI | InChI=1S/C15H23ClN2O2/c1-6-20-14(19)11-7-10(17)8-12(16)13(11)18-9(2)15(3,4)5/h7-9,18H,6,17H2,1-5H3 |
| InChIKey | SMMMANFZKGVIEF-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.81 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|